C18H18BrClN2O4 — CID 176915849
3-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]prop-2-ynoxymethyl acetate (PubChem CID 176915849) has the molecular formula C18H18BrClN2O4 and a molecular weight of 441.71 g/mol. Its IUPAC name is 3-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]prop-2-ynoxymethyl acetate.
| Compound Name | 3-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]prop-2-ynoxymethyl acetate |
|---|---|
| PubChem CID | 176915849 |
| Molecular Formula | C18H18BrClN2O4 |
| Molecular Weight | 441.71 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | 3-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]prop-2-ynoxymethyl acetate |
| SMILES | CC(=O)OCOCC#Cc1c(Cl)cc2c(cnn2C2CCCCO2)c1Br |
| InChI | InChI=1S/C18H18BrClN2O4/c1-12(23)26-11-24-7-4-5-13-15(20)9-16-14(18(13)19)10-21-22(16)17-6-2-3-8-25-17/h9-10,17H,2-3,6-8,11H2,1H3 |
| InChIKey | LJZZQRVSCHMEJU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.71 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|