C18H22BrClN2O4S — CID 171613708
2-[(1R,2R)-2-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]cyclopropyl]ethyl methanesulfonate (PubChem CID 171613708) has the molecular formula C18H22BrClN2O4S and a molecular weight of 477.81 g/mol. Its IUPAC name is 2-[(1R,2R)-2-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]cyclopropyl]ethyl methanesulfonate.
| Compound Name | 2-[(1R,2R)-2-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]cyclopropyl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 171613708 |
| Molecular Formula | C18H22BrClN2O4S |
| Molecular Weight | 477.81 g/mol |
| Exact Mass | 476.02 |
| IUPAC Name | 2-[(1R,2R)-2-[4-bromo-6-chloro-1-(oxan-2-yl)indazol-5-yl]cyclopropyl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC[C@H]1C[C@H]1c1c(Cl)cc2c(cnn2C2CCCCO2)c1Br |
| InChI | InChI=1S/C18H22BrClN2O4S/c1-27(23,24)26-7-5-11-8-12(11)17-14(20)9-15-13(18(17)19)10-21-22(15)16-4-2-3-6-25-16/h9-12,16H,2-8H2,1H3/t11-,12+,16?/m0/s1 |
| InChIKey | JYFYDSDLVNQWLQ-QXNREYOVSA-N |
| XLogP | 4.62 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.81 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|