C19H27BrN2O4S — CID 171613594
[4-[4-bromo-6-methyl-1-(oxan-2-yl)indazol-5-yl]-3-methylbutyl] methanesulfonate (PubChem CID 171613594) has the molecular formula C19H27BrN2O4S and a molecular weight of 459.41 g/mol. Its IUPAC name is [4-[4-bromo-6-methyl-1-(oxan-2-yl)indazol-5-yl]-3-methylbutyl] methanesulfonate.
| Compound Name | [4-[4-bromo-6-methyl-1-(oxan-2-yl)indazol-5-yl]-3-methylbutyl] methanesulfonate |
|---|---|
| PubChem CID | 171613594 |
| Molecular Formula | C19H27BrN2O4S |
| Molecular Weight | 459.41 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | [4-[4-bromo-6-methyl-1-(oxan-2-yl)indazol-5-yl]-3-methylbutyl] methanesulfonate |
| SMILES | Cc1cc2c(cnn2C2CCCCO2)c(Br)c1CC(C)CCOS(C)(=O)=O |
| InChI | InChI=1S/C19H27BrN2O4S/c1-13(7-9-26-27(3,23)24)10-15-14(2)11-17-16(19(15)20)12-21-22(17)18-6-4-5-8-25-18/h11-13,18H,4-10H2,1-3H3 |
| InChIKey | WIVACZYLTADPDV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|