C14H14BrF3N2O — CID 178018729
4-bromo-5-methyl-1-(oxan-2-yl)-6-(trifluoromethyl)indazole (PubChem CID 178018729) has the molecular formula C14H14BrF3N2O and a molecular weight of 363.18 g/mol. Its IUPAC name is 4-bromo-5-methyl-1-(oxan-2-yl)-6-(trifluoromethyl)indazole.
| Compound Name | 4-bromo-5-methyl-1-(oxan-2-yl)-6-(trifluoromethyl)indazole |
|---|---|
| PubChem CID | 178018729 |
| Molecular Formula | C14H14BrF3N2O |
| Molecular Weight | 363.18 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 4-bromo-5-methyl-1-(oxan-2-yl)-6-(trifluoromethyl)indazole |
| SMILES | Cc1c(C(F)(F)F)cc2c(cnn2C2CCCCO2)c1Br |
| InChI | InChI=1S/C14H14BrF3N2O/c1-8-10(14(16,17)18)6-11-9(13(8)15)7-19-20(11)12-4-2-3-5-21-12/h6-7,12H,2-5H2,1H3 |
| InChIKey | AUMSPIUNAWPUDK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.18 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |