C19H25BrN2O4 — CID 171613555
2-[4-bromo-6-methyl-1-(oxan-2-yl)indazol-5-yl]acetaldehyde;1,4-dioxane (PubChem CID 171613555) has the molecular formula C19H25BrN2O4 and a molecular weight of 425.32 g/mol. Its IUPAC name is 2-[4-bromo-6-methyl-1-(oxan-2-yl)indazol-5-yl]acetaldehyde;1,4-dioxane.
| Compound Name | 2-[4-bromo-6-methyl-1-(oxan-2-yl)indazol-5-yl]acetaldehyde;1,4-dioxane |
|---|---|
| PubChem CID | 171613555 |
| Molecular Formula | C19H25BrN2O4 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 2-[4-bromo-6-methyl-1-(oxan-2-yl)indazol-5-yl]acetaldehyde;1,4-dioxane |
| SMILES | C1COCCO1.Cc1cc2c(cnn2C2CCCCO2)c(Br)c1CC=O |
| InChI | InChI=1S/C15H17BrN2O2.C4H8O2/c1-10-8-13-12(15(16)11(10)5-6-19)9-17-18(13)14-4-2-3-7-20-14;1-2-6-4-3-5-1/h6,8-9,14H,2-5,7H2,1H3;1-4H2 |
| InChIKey | UVJIOBWNDPMQII-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|