C28H42BrN3O5 — CID 171613149
tert-butyl 2-[1-[4-[4-bromo-6-methyl-1-(oxan-2-yl)indazol-5-yl]butoxy]ethyl]morpholine-4-carboxylate (PubChem CID 171613149) has the molecular formula C28H42BrN3O5 and a molecular weight of 580.56 g/mol. Its IUPAC name is tert-butyl 2-[1-[4-[4-bromo-6-methyl-1-(oxan-2-yl)indazol-5-yl]butoxy]ethyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-[1-[4-[4-bromo-6-methyl-1-(oxan-2-yl)indazol-5-yl]butoxy]ethyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 171613149 |
| Molecular Formula | C28H42BrN3O5 |
| Molecular Weight | 580.56 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | tert-butyl 2-[1-[4-[4-bromo-6-methyl-1-(oxan-2-yl)indazol-5-yl]butoxy]ethyl]morpholine-4-carboxylate |
| SMILES | Cc1cc2c(cnn2C2CCCCO2)c(Br)c1CCCCOC(C)C1CN(C(=O)OC(C)(C)C)CCO1 |
| InChI | InChI=1S/C28H42BrN3O5/c1-19-16-23-22(17-30-32(23)25-11-7-9-14-36-25)26(29)21(19)10-6-8-13-34-20(2)24-18-31(12-15-35-24)27(33)37-28(3,4)5/h16-17,20,24-25H,6-15,18H2,1-5H3 |
| InChIKey | LHVHBWQMWOEOMN-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 75.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|