C29H42BrN3O4 — CID 177285111
tert-butyl (3S)-3-[2-[[2-[4-bromo-6-methyl-1-(oxan-2-yl)indazol-5-yl]cyclopropyl]methoxy]ethyl]piperidine-1-carboxylate (PubChem CID 177285111) has the molecular formula C29H42BrN3O4 and a molecular weight of 576.58 g/mol. Its IUPAC name is tert-butyl (3S)-3-[2-[[2-[4-bromo-6-methyl-1-(oxan-2-yl)indazol-5-yl]cyclopropyl]methoxy]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[2-[[2-[4-bromo-6-methyl-1-(oxan-2-yl)indazol-5-yl]cyclopropyl]methoxy]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 177285111 |
| Molecular Formula | C29H42BrN3O4 |
| Molecular Weight | 576.58 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | tert-butyl (3S)-3-[2-[[2-[4-bromo-6-methyl-1-(oxan-2-yl)indazol-5-yl]cyclopropyl]methoxy]ethyl]piperidine-1-carboxylate |
| SMILES | Cc1cc2c(cnn2C2CCCCO2)c(Br)c1C1CC1COCC[C@@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C29H42BrN3O4/c1-19-14-24-23(16-31-33(24)25-9-5-6-12-36-25)27(30)26(19)22-15-21(22)18-35-13-10-20-8-7-11-32(17-20)28(34)37-29(2,3)4/h14,16,20-22,25H,5-13,15,17-18H2,1-4H3/t20-,21?,22?,25?/m0/s1 |
| InChIKey | WMAKFOBIFLXHSS-FVKNEOPFSA-N |
| XLogP | 6.96 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.58 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|