C21H28BrN3O4 — CID 162517315
tert-butyl 3-[[6-bromo-1-(oxan-2-yl)indazol-5-yl]oxymethyl]azetidine-1-carboxylate (PubChem CID 162517315) has the molecular formula C21H28BrN3O4 and a molecular weight of 466.38 g/mol. Its IUPAC name is tert-butyl 3-[[6-bromo-1-(oxan-2-yl)indazol-5-yl]oxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[6-bromo-1-(oxan-2-yl)indazol-5-yl]oxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 162517315 |
| Molecular Formula | C21H28BrN3O4 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | tert-butyl 3-[[6-bromo-1-(oxan-2-yl)indazol-5-yl]oxymethyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(COc2cc3cnn(C4CCCCO4)c3cc2Br)C1 |
| InChI | InChI=1S/C21H28BrN3O4/c1-21(2,3)29-20(26)24-11-14(12-24)13-28-18-8-15-10-23-25(17(15)9-16(18)22)19-6-4-5-7-27-19/h8-10,14,19H,4-7,11-13H2,1-3H3 |
| InChIKey | LOHJONGDAPIPRU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |