C15H18BrClINO3 — CID 164888669
tert-butyl 3-[(4-bromo-2-chloro-5-iodophenoxy)methyl]azetidine-1-carboxylate (PubChem CID 164888669) has the molecular formula C15H18BrClINO3 and a molecular weight of 502.57 g/mol. Its IUPAC name is tert-butyl 3-[(4-bromo-2-chloro-5-iodophenoxy)methyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(4-bromo-2-chloro-5-iodophenoxy)methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 164888669 |
| Molecular Formula | C15H18BrClINO3 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 500.92 |
| IUPAC Name | tert-butyl 3-[(4-bromo-2-chloro-5-iodophenoxy)methyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(COc2cc(I)c(Br)cc2Cl)C1 |
| InChI | InChI=1S/C15H18BrClINO3/c1-15(2,3)22-14(20)19-6-9(7-19)8-21-13-5-12(18)10(16)4-11(13)17/h4-5,9H,6-8H2,1-3H3 |
| InChIKey | RCVGTPBMWRSMQI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|