C18H23ClINO5 — CID 172648588
5-chloro-4-iodo-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methoxy]benzoic acid (PubChem CID 172648588) has the molecular formula C18H23ClINO5 and a molecular weight of 495.74 g/mol. Its IUPAC name is 5-chloro-4-iodo-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methoxy]benzoic acid.
| Compound Name | 5-chloro-4-iodo-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 172648588 |
| Molecular Formula | C18H23ClINO5 |
| Molecular Weight | 495.74 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | 5-chloro-4-iodo-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methoxy]benzoic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC(COc2cc(I)c(Cl)cc2C(=O)O)CC1 |
| InChI | InChI=1S/C18H23ClINO5/c1-18(2,3)26-17(24)21-6-4-11(5-7-21)10-25-15-9-14(20)13(19)8-12(15)16(22)23/h8-9,11H,4-7,10H2,1-3H3,(H,22,23) |
| InChIKey | DWXAYFJGGIHSQF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.74 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|