C21H31NO5 — CID 165416509
2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methoxy]-4-propan-2-ylbenzoic acid (PubChem CID 165416509) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is 2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methoxy]-4-propan-2-ylbenzoic acid.
| Compound Name | 2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methoxy]-4-propan-2-ylbenzoic acid |
|---|---|
| PubChem CID | 165416509 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methoxy]-4-propan-2-ylbenzoic acid |
| SMILES | CC(C)c1ccc(C(=O)O)c(OCC2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C21H31NO5/c1-14(2)16-6-7-17(19(23)24)18(12-16)26-13-15-8-10-22(11-9-15)20(25)27-21(3,4)5/h6-7,12,14-15H,8-11,13H2,1-5H3,(H,23,24) |
| InChIKey | ODTPTKCTFIJNRN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |