C22H33NO5 — CID 68534159
4-tert-butyl-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]methoxy]benzoic acid (PubChem CID 68534159) has the molecular formula C22H33NO5 and a molecular weight of 391.51 g/mol. Its IUPAC name is 4-tert-butyl-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]methoxy]benzoic acid.
| Compound Name | 4-tert-butyl-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 68534159 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | 4-tert-butyl-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]methoxy]benzoic acid |
| SMILES | CC(C)(C)OC(=O)N1CCCC(COc2cc(C(C)(C)C)ccc2C(=O)O)C1 |
| InChI | InChI=1S/C22H33NO5/c1-21(2,3)16-9-10-17(19(24)25)18(12-16)27-14-15-8-7-11-23(13-15)20(26)28-22(4,5)6/h9-10,12,15H,7-8,11,13-14H2,1-6H3,(H,24,25) |
| InChIKey | UNEDXKITDXAEPX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |