C17H23F2NO3 — CID 24902536
tert-butyl 3-[(2,6-difluorophenoxy)methyl]piperidine-1-carboxylate (PubChem CID 24902536) has the molecular formula C17H23F2NO3 and a molecular weight of 327.37 g/mol. Its IUPAC name is tert-butyl 3-[(2,6-difluorophenoxy)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2,6-difluorophenoxy)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24902536 |
| Molecular Formula | C17H23F2NO3 |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | tert-butyl 3-[(2,6-difluorophenoxy)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(COc2c(F)cccc2F)C1 |
| InChI | InChI=1S/C17H23F2NO3/c1-17(2,3)23-16(21)20-9-5-6-12(10-20)11-22-15-13(18)7-4-8-14(15)19/h4,7-8,12H,5-6,9-11H2,1-3H3 |
| InChIKey | FJTCVTXISYHGST-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |