C21H28FNO4 — CID 67193895
tert-butyl 3-[2-(cyclopropylmethoxy)-3-fluorobenzoyl]piperidine-1-carboxylate (PubChem CID 67193895) has the molecular formula C21H28FNO4 and a molecular weight of 377.46 g/mol. Its IUPAC name is tert-butyl 3-[2-(cyclopropylmethoxy)-3-fluorobenzoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(cyclopropylmethoxy)-3-fluorobenzoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67193895 |
| Molecular Formula | C21H28FNO4 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | tert-butyl 3-[2-(cyclopropylmethoxy)-3-fluorobenzoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C(=O)c2cccc(F)c2OCC2CC2)C1 |
| InChI | InChI=1S/C21H28FNO4/c1-21(2,3)27-20(25)23-11-5-6-15(12-23)18(24)16-7-4-8-17(22)19(16)26-13-14-9-10-14/h4,7-8,14-15H,5-6,9-13H2,1-3H3 |
| InChIKey | PRDFAUYSEAMYRE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |