C16H19F2NO3 — CID 107091983
tert-butyl 3-(2,6-difluorobenzoyl)pyrrolidine-1-carboxylate (PubChem CID 107091983) has the molecular formula C16H19F2NO3 and a molecular weight of 311.33 g/mol. Its IUPAC name is tert-butyl 3-(2,6-difluorobenzoyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2,6-difluorobenzoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 107091983 |
| Molecular Formula | C16H19F2NO3 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | tert-butyl 3-(2,6-difluorobenzoyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)c2c(F)cccc2F)C1 |
| InChI | InChI=1S/C16H19F2NO3/c1-16(2,3)22-15(21)19-8-7-10(9-19)14(20)13-11(17)5-4-6-12(13)18/h4-6,10H,7-9H2,1-3H3 |
| InChIKey | PBZVUOYTPMNIEX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |