C19H28FNO5 — CID 145220856
tert-butyl 3-(hydroxymethyl)piperidine-1-carboxylate;methyl 2-fluorobenzoate (PubChem CID 145220856) has the molecular formula C19H28FNO5 and a molecular weight of 369.43 g/mol. Its IUPAC name is tert-butyl 3-(hydroxymethyl)piperidine-1-carboxylate;methyl 2-fluorobenzoate.
| Compound Name | tert-butyl 3-(hydroxymethyl)piperidine-1-carboxylate;methyl 2-fluorobenzoate |
|---|---|
| PubChem CID | 145220856 |
| Molecular Formula | C19H28FNO5 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | tert-butyl 3-(hydroxymethyl)piperidine-1-carboxylate;methyl 2-fluorobenzoate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CO)C1.COC(=O)c1ccccc1F |
| InChI | InChI=1S/C11H21NO3.C8H7FO2/c1-11(2,3)15-10(14)12-6-4-5-9(7-12)8-13;1-11-8(10)6-4-2-3-5-7(6)9/h9,13H,4-8H2,1-3H3;2-5H,1H3 |
| InChIKey | YHGWSNPFVGBISZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |