C17H25F2NO3 — CID 144885911
tert-butyl 3-fluoropiperidine-1-carboxylate;1-fluoro-2-methoxybenzene (PubChem CID 144885911) has the molecular formula C17H25F2NO3 and a molecular weight of 329.39 g/mol. Its IUPAC name is tert-butyl 3-fluoropiperidine-1-carboxylate;1-fluoro-2-methoxybenzene.
| Compound Name | tert-butyl 3-fluoropiperidine-1-carboxylate;1-fluoro-2-methoxybenzene |
|---|---|
| PubChem CID | 144885911 |
| Molecular Formula | C17H25F2NO3 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | tert-butyl 3-fluoropiperidine-1-carboxylate;1-fluoro-2-methoxybenzene |
| SMILES | CC(C)(C)OC(=O)N1CCCC(F)C1.COc1ccccc1F |
| InChI | InChI=1S/C10H18FNO2.C7H7FO/c1-10(2,3)14-9(13)12-6-4-5-8(11)7-12;1-9-7-5-3-2-4-6(7)8/h8H,4-7H2,1-3H3;2-5H,1H3 |
| InChIKey | XRVZFPHVAAUGAJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |