C19H29FN2O3 — CID 113261587
tert-butyl 3-[1-(2-fluoro-6-methoxyphenyl)ethylamino]piperidine-1-carboxylate (PubChem CID 113261587) has the molecular formula C19H29FN2O3 and a molecular weight of 352.45 g/mol. Its IUPAC name is tert-butyl 3-[1-(2-fluoro-6-methoxyphenyl)ethylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-(2-fluoro-6-methoxyphenyl)ethylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113261587 |
| Molecular Formula | C19H29FN2O3 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | tert-butyl 3-[1-(2-fluoro-6-methoxyphenyl)ethylamino]piperidine-1-carboxylate |
| SMILES | COc1cccc(F)c1C(C)NC1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H29FN2O3/c1-13(17-15(20)9-6-10-16(17)24-5)21-14-8-7-11-22(12-14)18(23)25-19(2,3)4/h6,9-10,13-14,21H,7-8,11-12H2,1-5H3 |
| InChIKey | JORQRDYPEKZJGI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |