C19H28Cl2N2O2 — CID 114079617
tert-butyl 3-[1-(2,3-dichlorophenyl)ethylamino]azepane-1-carboxylate (PubChem CID 114079617) has the molecular formula C19H28Cl2N2O2 and a molecular weight of 387.35 g/mol. Its IUPAC name is tert-butyl 3-[1-(2,3-dichlorophenyl)ethylamino]azepane-1-carboxylate.
| Compound Name | tert-butyl 3-[1-(2,3-dichlorophenyl)ethylamino]azepane-1-carboxylate |
|---|---|
| PubChem CID | 114079617 |
| Molecular Formula | C19H28Cl2N2O2 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | tert-butyl 3-[1-(2,3-dichlorophenyl)ethylamino]azepane-1-carboxylate |
| SMILES | CC(NC1CCCCN(C(=O)OC(C)(C)C)C1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H28Cl2N2O2/c1-13(15-9-7-10-16(20)17(15)21)22-14-8-5-6-11-23(12-14)18(24)25-19(2,3)4/h7,9-10,13-14,22H,5-6,8,11-12H2,1-4H3 |
| InChIKey | WYDJIKFLVMLHBZ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |