C14H18Cl2N2O2 — CID 63422241
tert-butyl 3-(2,3-dichloroanilino)azetidine-1-carboxylate (PubChem CID 63422241) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is tert-butyl 3-(2,3-dichloroanilino)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2,3-dichloroanilino)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 63422241 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | tert-butyl 3-(2,3-dichloroanilino)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Nc2cccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C14H18Cl2N2O2/c1-14(2,3)20-13(19)18-7-9(8-18)17-11-6-4-5-10(15)12(11)16/h4-6,9,17H,7-8H2,1-3H3 |
| InChIKey | FUUINYRZBVAWMW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |