C15H20Cl2N2O2 — CID 71432777
tert-butyl 3-(2,3-dichlorophenyl)piperazine-1-carboxylate (PubChem CID 71432777) has the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is tert-butyl 3-(2,3-dichlorophenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-(2,3-dichlorophenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 71432777 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | tert-butyl 3-(2,3-dichlorophenyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNC(c2cccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C15H20Cl2N2O2/c1-15(2,3)21-14(20)19-8-7-18-12(9-19)10-5-4-6-11(16)13(10)17/h4-6,12,18H,7-9H2,1-3H3 |
| InChIKey | UQFCGECXOICQHY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |