C16H24N2O2S — CID 83806256
tert-butyl 3-(2-methylsulfanylphenyl)piperazine-1-carboxylate (PubChem CID 83806256) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is tert-butyl 3-(2-methylsulfanylphenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-methylsulfanylphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 83806256 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | tert-butyl 3-(2-methylsulfanylphenyl)piperazine-1-carboxylate |
| SMILES | CSc1ccccc1C1CN(C(=O)OC(C)(C)C)CCN1 |
| InChI | InChI=1S/C16H24N2O2S/c1-16(2,3)20-15(19)18-10-9-17-13(11-18)12-7-5-6-8-14(12)21-4/h5-8,13,17H,9-11H2,1-4H3 |
| InChIKey | WZVSPOSTGZGFMM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |