C13H27ClN2O2 — CID 57355298
tert-butyl 3-tert-butylpiperazine-1-carboxylate;hydrochloride (PubChem CID 57355298) has the molecular formula C13H27ClN2O2 and a molecular weight of 278.82 g/mol. Its IUPAC name is tert-butyl 3-tert-butylpiperazine-1-carboxylate;hydrochloride.
| Compound Name | tert-butyl 3-tert-butylpiperazine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 57355298 |
| Molecular Formula | C13H27ClN2O2 |
| Molecular Weight | 278.82 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | tert-butyl 3-tert-butylpiperazine-1-carboxylate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)N1CCNC(C(C)(C)C)C1.Cl |
| InChI | InChI=1S/C13H26N2O2.ClH/c1-12(2,3)10-9-15(8-7-14-10)11(16)17-13(4,5)6;/h10,14H,7-9H2,1-6H3;1H |
| InChIKey | CADRPFQADWMMKS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.82 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |