C13H28N2O2 — CID 176939375
tert-butyl (3R)-3-ethenylpiperazine-1-carboxylate;ethane;molecular hydrogen (PubChem CID 176939375) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is tert-butyl (3R)-3-ethenylpiperazine-1-carboxylate;ethane;molecular hydrogen.
| Compound Name | tert-butyl (3R)-3-ethenylpiperazine-1-carboxylate;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 176939375 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | tert-butyl (3R)-3-ethenylpiperazine-1-carboxylate;ethane;molecular hydrogen |
| SMILES | C=C[C@@H]1CN(C(=O)OC(C)(C)C)CCN1.CC.[H][H] |
| InChI | InChI=1S/C11H20N2O2.C2H6.H2/c1-5-9-8-13(7-6-12-9)10(14)15-11(2,3)4;1-2;/h5,9,12H,1,6-8H2,2-4H3;1-2H3;1H/t9-;;/m1../s1 |
| InChIKey | HHFWXTZFKYKVMV-KLQYNRQASA-N |
| XLogP | 2.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|