C10H21ClN2O2 — CID 24820292
tert-butyl 3-methylpiperazine-1-carboxylate;hydrochloride (PubChem CID 24820292) has the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. Its IUPAC name is tert-butyl 3-methylpiperazine-1-carboxylate;hydrochloride.
| Compound Name | tert-butyl 3-methylpiperazine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 24820292 |
| Molecular Formula | C10H21ClN2O2 |
| Molecular Weight | 236.74 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | tert-butyl 3-methylpiperazine-1-carboxylate;hydrochloride |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCN1.Cl |
| InChI | InChI=1S/C10H20N2O2.ClH/c1-8-7-12(6-5-11-8)9(13)14-10(2,3)4;/h8,11H,5-7H2,1-4H3;1H |
| InChIKey | SYNMIMWDYFYCCC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.74 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |