C13H24N2O2 — CID 176939396
tert-butyl 3-(2-methylprop-2-enyl)piperazine-1-carboxylate (PubChem CID 176939396) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is tert-butyl 3-(2-methylprop-2-enyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-methylprop-2-enyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 176939396 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | tert-butyl 3-(2-methylprop-2-enyl)piperazine-1-carboxylate |
| SMILES | C=C(C)CC1CN(C(=O)OC(C)(C)C)CCN1 |
| InChI | InChI=1S/C13H24N2O2/c1-10(2)8-11-9-15(7-6-14-11)12(16)17-13(3,4)5/h11,14H,1,6-9H2,2-5H3 |
| InChIKey | ASOUEKWZCDZLCK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|