C15H19F3N2O2 — CID 91666765
tert-butyl 3-(3,4,5-trifluorophenyl)piperazine-1-carboxylate (PubChem CID 91666765) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is tert-butyl 3-(3,4,5-trifluorophenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-(3,4,5-trifluorophenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 91666765 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | tert-butyl 3-(3,4,5-trifluorophenyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNC(c2cc(F)c(F)c(F)c2)C1 |
| InChI | InChI=1S/C15H19F3N2O2/c1-15(2,3)22-14(21)20-5-4-19-12(8-20)9-6-10(16)13(18)11(17)7-9/h6-7,12,19H,4-5,8H2,1-3H3 |
| InChIKey | FLXATNQSKUMKED-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|