C16H20BrCl2NO2 — CID 57372185
tert-butyl (3S,4R)-3-(bromomethyl)-4-(2,3-dichlorophenyl)pyrrolidine-1-carboxylate (PubChem CID 57372185) has the molecular formula C16H20BrCl2NO2 and a molecular weight of 409.15 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-(bromomethyl)-4-(2,3-dichlorophenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-3-(bromomethyl)-4-(2,3-dichlorophenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57372185 |
| Molecular Formula | C16H20BrCl2NO2 |
| Molecular Weight | 409.15 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | tert-butyl (3S,4R)-3-(bromomethyl)-4-(2,3-dichlorophenyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](CBr)[C@H](c2cccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C16H20BrCl2NO2/c1-16(2,3)22-15(21)20-8-10(7-17)12(9-20)11-5-4-6-13(18)14(11)19/h4-6,10,12H,7-9H2,1-3H3/t10-,12-/m1/s1 |
| InChIKey | QCASZEISMMKBTH-ZYHUDNBSSA-N |
| XLogP | 5.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.15 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|