C16H19ClN2O3 — CID 69055020
tert-butyl (3aS,9bR)-6-chloro-5-oxo-3,3a,4,9b-tetrahydro-1H-pyrrolo[3,4-c]isoquinoline-2-carboxylate (PubChem CID 69055020) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is tert-butyl (3aS,9bR)-6-chloro-5-oxo-3,3a,4,9b-tetrahydro-1H-pyrrolo[3,4-c]isoquinoline-2-carboxylate.
| Compound Name | tert-butyl (3aS,9bR)-6-chloro-5-oxo-3,3a,4,9b-tetrahydro-1H-pyrrolo[3,4-c]isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 69055020 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | tert-butyl (3aS,9bR)-6-chloro-5-oxo-3,3a,4,9b-tetrahydro-1H-pyrrolo[3,4-c]isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2NC(=O)c3c(Cl)cccc3[C@@H]2C1 |
| InChI | InChI=1S/C16H19ClN2O3/c1-16(2,3)22-15(21)19-7-10-9-5-4-6-11(17)13(9)14(20)18-12(10)8-19/h4-6,10,12H,7-8H2,1-3H3,(H,18,20)/t10-,12+/m0/s1 |
| InChIKey | GAIYCJJGZQGCIL-CMPLNLGQSA-N |
| XLogP | 2.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |