C21H28N2O2 — CID 90726340
tert-butyl 5-penta-1,3-dienyl-1,3,3a,4,5,9b-hexahydropyrrolo[3,4-c]isoquinoline-2-carboxylate (PubChem CID 90726340) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is tert-butyl 5-penta-1,3-dienyl-1,3,3a,4,5,9b-hexahydropyrrolo[3,4-c]isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 5-penta-1,3-dienyl-1,3,3a,4,5,9b-hexahydropyrrolo[3,4-c]isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 90726340 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | tert-butyl 5-penta-1,3-dienyl-1,3,3a,4,5,9b-hexahydropyrrolo[3,4-c]isoquinoline-2-carboxylate |
| SMILES | CC=CC=CC1NC2CN(C(=O)OC(C)(C)C)CC2c2ccccc21 |
| InChI | InChI=1S/C21H28N2O2/c1-5-6-7-12-18-16-11-9-8-10-15(16)17-13-23(14-19(17)22-18)20(24)25-21(2,3)4/h5-12,17-19,22H,13-14H2,1-4H3 |
| InChIKey | ZSSRIQOTANBHBS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|