C23H30N2O2 — CID 156757897
tert-butyl 3,5-dibenzylpiperazine-1-carboxylate (PubChem CID 156757897) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is tert-butyl 3,5-dibenzylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 3,5-dibenzylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 156757897 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | tert-butyl 3,5-dibenzylpiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Cc2ccccc2)NC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H30N2O2/c1-23(2,3)27-22(26)25-16-20(14-18-10-6-4-7-11-18)24-21(17-25)15-19-12-8-5-9-13-19/h4-13,20-21,24H,14-17H2,1-3H3 |
| InChIKey | GIECJXKEFLALNU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |