C25H26N2O — CID 102468577
[(3S,5S)-3,5-dibenzylpiperazin-1-yl]-phenylmethanone (PubChem CID 102468577) has the molecular formula C25H26N2O and a molecular weight of 370.50 g/mol. Its IUPAC name is [(3S,5S)-3,5-dibenzylpiperazin-1-yl]-phenylmethanone.
| Compound Name | [(3S,5S)-3,5-dibenzylpiperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 102468577 |
| Molecular Formula | C25H26N2O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | [(3S,5S)-3,5-dibenzylpiperazin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1C[C@H](Cc2ccccc2)N[C@@H](Cc2ccccc2)C1 |
| InChI | InChI=1S/C25H26N2O/c28-25(22-14-8-3-9-15-22)27-18-23(16-20-10-4-1-5-11-20)26-24(19-27)17-21-12-6-2-7-13-21/h1-15,23-24,26H,16-19H2/t23-,24-/m0/s1 |
| InChIKey | JEONGOAHZLDZQX-ZEQRLZLVSA-N |
| XLogP | 3.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |