C19H20N2O2 — CID 11738375
(5S)-1-benzoyl-5-benzyl-3-methyl-1,3-diazinan-4-one (PubChem CID 11738375) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is (5S)-1-benzoyl-5-benzyl-3-methyl-1,3-diazinan-4-one.
| Compound Name | (5S)-1-benzoyl-5-benzyl-3-methyl-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 11738375 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (5S)-1-benzoyl-5-benzyl-3-methyl-1,3-diazinan-4-one |
| SMILES | CN1CN(C(=O)c2ccccc2)C[C@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C19H20N2O2/c1-20-14-21(19(23)16-10-6-3-7-11-16)13-17(18(20)22)12-15-8-4-2-5-9-15/h2-11,17H,12-14H2,1H3/t17-/m0/s1 |
| InChIKey | OXDYDYAQURUNOR-KRWDZBQOSA-N |
| XLogP | 2.42 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |