C22H26N2O2 — CID 91703996
(2S,5R)-1-benzoyl-5-benzyl-2-tert-butyl-3-methylimidazolidin-4-one (PubChem CID 91703996) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is (2S,5R)-1-benzoyl-5-benzyl-2-tert-butyl-3-methylimidazolidin-4-one.
| Compound Name | (2S,5R)-1-benzoyl-5-benzyl-2-tert-butyl-3-methylimidazolidin-4-one |
|---|---|
| PubChem CID | 91703996 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (2S,5R)-1-benzoyl-5-benzyl-2-tert-butyl-3-methylimidazolidin-4-one |
| SMILES | CN1C(=O)[C@@H](Cc2ccccc2)N(C(=O)c2ccccc2)[C@H]1C(C)(C)C |
| InChI | InChI=1S/C22H26N2O2/c1-22(2,3)21-23(4)20(26)18(15-16-11-7-5-8-12-16)24(21)19(25)17-13-9-6-10-14-17/h5-14,18,21H,15H2,1-4H3/t18-,21+/m1/s1 |
| InChIKey | GMJFJWFFHGOAQW-NQIIRXRSSA-N |
| XLogP | 3.58 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |