C22H22N2O4 — CID 4680633
1,4-diacetyl-3,6-dibenzylpiperazine-2,5-dione (PubChem CID 4680633) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 1,4-diacetyl-3,6-dibenzylpiperazine-2,5-dione.
| Compound Name | 1,4-diacetyl-3,6-dibenzylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 4680633 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1,4-diacetyl-3,6-dibenzylpiperazine-2,5-dione |
| SMILES | CC(=O)N1C(=O)C(Cc2ccccc2)N(C(C)=O)C(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C22H22N2O4/c1-15(25)23-19(13-17-9-5-3-6-10-17)22(28)24(16(2)26)20(21(23)27)14-18-11-7-4-8-12-18/h3-12,19-20H,13-14H2,1-2H3 |
| InChIKey | CHUOLQZODKVFAI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |