C11H11N3O3 — CID 70583178
5-benzyl-2,4-dioxoimidazolidine-1-carboxamide (PubChem CID 70583178) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 5-benzyl-2,4-dioxoimidazolidine-1-carboxamide.
| Compound Name | 5-benzyl-2,4-dioxoimidazolidine-1-carboxamide |
|---|---|
| PubChem CID | 70583178 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 5-benzyl-2,4-dioxoimidazolidine-1-carboxamide |
| SMILES | NC(=O)N1C(=O)NC(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C11H11N3O3/c12-10(16)14-8(9(15)13-11(14)17)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H2,12,16)(H,13,15,17) |
| InChIKey | BFORWNNUBPVBMG-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|