C15H17NO3 — CID 140533636
(3Z,5S)-5-benzyl-1-ethyl-3-(1-hydroxyethylidene)pyrrolidine-2,4-dione (PubChem CID 140533636) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is (3Z,5S)-5-benzyl-1-ethyl-3-(1-hydroxyethylidene)pyrrolidine-2,4-dione.
| Compound Name | (3Z,5S)-5-benzyl-1-ethyl-3-(1-hydroxyethylidene)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 140533636 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (3Z,5S)-5-benzyl-1-ethyl-3-(1-hydroxyethylidene)pyrrolidine-2,4-dione |
| SMILES | CCN1C(=O)/C(=C(/C)O)C(=O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C15H17NO3/c1-3-16-12(9-11-7-5-4-6-8-11)14(18)13(10(2)17)15(16)19/h4-8,12,17H,3,9H2,1-2H3/b13-10-/t12-/m0/s1 |
| InChIKey | UBRQRYMCYPLHAA-IXJPEXDMSA-N |
| XLogP | 1.86 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|