C21H17NO4 — CID 10617632
ethyl 3-benzyl-2,5-dioxo-3H-pyrrolo[2,1-a]isoindole-1-carboxylate (PubChem CID 10617632) has the molecular formula C21H17NO4 and a molecular weight of 347.37 g/mol. Its IUPAC name is ethyl 3-benzyl-2,5-dioxo-3H-pyrrolo[2,1-a]isoindole-1-carboxylate.
| Compound Name | ethyl 3-benzyl-2,5-dioxo-3H-pyrrolo[2,1-a]isoindole-1-carboxylate |
|---|---|
| PubChem CID | 10617632 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | ethyl 3-benzyl-2,5-dioxo-3H-pyrrolo[2,1-a]isoindole-1-carboxylate |
| SMILES | CCOC(=O)C1=C2c3ccccc3C(=O)N2C(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C21H17NO4/c1-2-26-21(25)17-18-14-10-6-7-11-15(14)20(24)22(18)16(19(17)23)12-13-8-4-3-5-9-13/h3-11,16H,2,12H2,1H3 |
| InChIKey | JHCXUBISGRHICL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|