C15H18N2O3 — CID 102408068
ethyl 1,3-dimethyl-6-oxo-2-phenyl-2H-pyrimidine-4-carboxylate (PubChem CID 102408068) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is ethyl 1,3-dimethyl-6-oxo-2-phenyl-2H-pyrimidine-4-carboxylate.
| Compound Name | ethyl 1,3-dimethyl-6-oxo-2-phenyl-2H-pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 102408068 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | ethyl 1,3-dimethyl-6-oxo-2-phenyl-2H-pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)C1=CC(=O)N(C)C(c2ccccc2)N1C |
| InChI | InChI=1S/C15H18N2O3/c1-4-20-15(19)12-10-13(18)17(3)14(16(12)2)11-8-6-5-7-9-11/h5-10,14H,4H2,1-3H3 |
| InChIKey | MTSBRNGRHNFVHH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |