ethyl 1,3-dimethyl-6-oxo-2-phenyl-2H-pyrimidine-4-carboxylate

C15H18N2O3 — CID 102408068

IUPACethyl 1,3-dimethyl-6-oxo-2-phenyl-2H-pyrimidine-4-carboxylate
SMILESCCOC(=O)C1=CC(=O)N(C)C(c2ccccc2)N1C
InChIInChI=1S/C15H18N2O3/c1-4-20-15(19)12-10-13(18)17(3)14(16(12)2)11-8-6-5-7-9-11/h5-10,14H,4H2,1-3H3
InChIKeyMTSBRNGRHNFVHH-UHFFFAOYSA-N
MW274.32 g/mol
LogP1.54
Rot. Bonds3

About ethyl 1,3-dimethyl-6-oxo-2-phenyl-2H-pyrimidine-4-carboxylate

ethyl 1,3-dimethyl-6-oxo-2-phenyl-2H-pyrimidine-4-carboxylate (PubChem CID 102408068) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is ethyl 1,3-dimethyl-6-oxo-2-phenyl-2H-pyrimidine-4-carboxylate.

Molecular Properties

Compound Nameethyl 1,3-dimethyl-6-oxo-2-phenyl-2H-pyrimidine-4-carboxylate
PubChem CID102408068
Molecular FormulaC15H18N2O3
Molecular Weight274.32 g/mol
Exact Mass274.13
IUPAC Nameethyl 1,3-dimethyl-6-oxo-2-phenyl-2H-pyrimidine-4-carboxylate
SMILESCCOC(=O)C1=CC(=O)N(C)C(c2ccccc2)N1C
InChIInChI=1S/C15H18N2O3/c1-4-20-15(19)12-10-13(18)17(3)14(16(12)2)11-8-6-5-7-9-11/h5-10,14H,4H2,1-3H3
InChIKeyMTSBRNGRHNFVHH-UHFFFAOYSA-N
XLogP1.54
TPSA49.85 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.32
LogP ≤ 51.54
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 1,3-dimethyl-6-oxo-2-phenyl-2H-pyrimidine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 1,3-dimethyl-6-oxo-2-phenyl-2H-pyrimidine-4-carboxylate?
The IUPAC name of ethyl 1,3-dimethyl-6-oxo-2-phenyl-2H-pyrimidine-4-carboxylate (CID 102408068) is ethyl 1,3-dimethyl-6-oxo-2-phenyl-2H-pyrimidine-4-carboxylate.
What is the SMILES notation for ethyl 1,3-dimethyl-6-oxo-2-phenyl-2H-pyrimidine-4-carboxylate?
The canonical SMILES for ethyl 1,3-dimethyl-6-oxo-2-phenyl-2H-pyrimidine-4-carboxylate is CCOC(=O)C1=CC(=O)N(C)C(c2ccccc2)N1C.
What is the InChIKey of ethyl 1,3-dimethyl-6-oxo-2-phenyl-2H-pyrimidine-4-carboxylate?
The InChIKey is MTSBRNGRHNFVHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3/c1-4-20-15(19)12-10-13(18)17(3)14(16(12)2)11-8-6-5-7-9-11/h5-10,14H,4H2,1-3H3.
What are the key properties of ethyl 1,3-dimethyl-6-oxo-2-phenyl-2H-pyrimidine-4-carboxylate?
ethyl 1,3-dimethyl-6-oxo-2-phenyl-2H-pyrimidine-4-carboxylate has a molecular weight of 274.32 g/mol, XLogP of 1.54, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1,3-dimethyl-6-oxo-2-phenyl-2H-pyrimidine-4-carboxylate is sourced from PubChem (CID 102408068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).