C26H22O3 — CID 132560560
ethyl (4R,5R)-3-oxo-2,4,5-triphenylcyclopentene-1-carboxylate (PubChem CID 132560560) has the molecular formula C26H22O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is ethyl (4R,5R)-3-oxo-2,4,5-triphenylcyclopentene-1-carboxylate.
| Compound Name | ethyl (4R,5R)-3-oxo-2,4,5-triphenylcyclopentene-1-carboxylate |
|---|---|
| PubChem CID | 132560560 |
| Molecular Formula | C26H22O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | ethyl (4R,5R)-3-oxo-2,4,5-triphenylcyclopentene-1-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)C(=O)[C@@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C26H22O3/c1-2-29-26(28)24-21(18-12-6-3-7-13-18)22(19-14-8-4-9-15-19)25(27)23(24)20-16-10-5-11-17-20/h3-17,21-22H,2H2,1H3/t21-,22-/m0/s1 |
| InChIKey | MBIXEZUOPRJSHB-VXKWHMMOSA-N |
| XLogP | 5.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |