C24H24O2 — CID 24778104
ethyl (1R,2S,5R,6S,9R)-4,9-diphenyltricyclo[4.2.1.02,5]non-3-ene-3-carboxylate (PubChem CID 24778104) has the molecular formula C24H24O2 and a molecular weight of 344.45 g/mol. Its IUPAC name is ethyl (1R,2S,5R,6S,9R)-4,9-diphenyltricyclo[4.2.1.02,5]non-3-ene-3-carboxylate.
| Compound Name | ethyl (1R,2S,5R,6S,9R)-4,9-diphenyltricyclo[4.2.1.02,5]non-3-ene-3-carboxylate |
|---|---|
| PubChem CID | 24778104 |
| Molecular Formula | C24H24O2 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | ethyl (1R,2S,5R,6S,9R)-4,9-diphenyltricyclo[4.2.1.02,5]non-3-ene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)[C@@H]2[C@H]3CC[C@@H]([C@H]12)[C@@H]3c1ccccc1 |
| InChI | InChI=1S/C24H24O2/c1-2-26-24(25)23-20(16-11-7-4-8-12-16)21-17-13-14-18(22(21)23)19(17)15-9-5-3-6-10-15/h3-12,17-19,21-22H,2,13-14H2,1H3/t17-,18+,19+,21-,22-/m0/s1 |
| InChIKey | KSBHRQZIDOOEGZ-YMYKFTITSA-N |
| XLogP | 5.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |