C20H20O4 — CID 101154723
ethyl (1S,2R,5S,6R,9R)-9-acetyloxy-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene-3-carboxylate (PubChem CID 101154723) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is ethyl (1S,2R,5S,6R,9R)-9-acetyloxy-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene-3-carboxylate.
| Compound Name | ethyl (1S,2R,5S,6R,9R)-9-acetyloxy-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene-3-carboxylate |
|---|---|
| PubChem CID | 101154723 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | ethyl (1S,2R,5S,6R,9R)-9-acetyloxy-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)[C@@H]2[C@H]3C=C[C@H]([C@@H]3OC(C)=O)[C@H]12 |
| InChI | InChI=1S/C20H20O4/c1-3-23-20(22)18-15(12-7-5-4-6-8-12)16-13-9-10-14(17(16)18)19(13)24-11(2)21/h4-10,13-14,16-17,19H,3H2,1-2H3/t13-,14+,16+,17+,19-/m1/s1 |
| InChIKey | YEKQCHIQNYUKAQ-HGIHFSPSSA-N |
| XLogP | 3.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|