C36H32O4 — CID 92844906
diethyl (1R,2S)-3,4,5,6-tetraphenylcyclohexa-3,5-diene-1,2-dicarboxylate (PubChem CID 92844906) has the molecular formula C36H32O4 and a molecular weight of 528.65 g/mol. Its IUPAC name is diethyl (1R,2S)-3,4,5,6-tetraphenylcyclohexa-3,5-diene-1,2-dicarboxylate.
| Compound Name | diethyl (1R,2S)-3,4,5,6-tetraphenylcyclohexa-3,5-diene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 92844906 |
| Molecular Formula | C36H32O4 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | diethyl (1R,2S)-3,4,5,6-tetraphenylcyclohexa-3,5-diene-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C(c2ccccc2)=C(c2ccccc2)C(c2ccccc2)=C(c2ccccc2)[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C36H32O4/c1-3-39-35(37)33-31(27-21-13-7-14-22-27)29(25-17-9-5-10-18-25)30(26-19-11-6-12-20-26)32(28-23-15-8-16-24-28)34(33)36(38)40-4-2/h5-24,33-34H,3-4H2,1-2H3/t33-,34+ |
| InChIKey | KQUZEPKMEBLUIM-AQOUDTPCSA-N |
| XLogP | 7.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|