C19H19NO3 — CID 129438808
ethyl (3S,4S,5S)-2-oxo-4,5-diphenylpyrrolidine-3-carboxylate (PubChem CID 129438808) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is ethyl (3S,4S,5S)-2-oxo-4,5-diphenylpyrrolidine-3-carboxylate.
| Compound Name | ethyl (3S,4S,5S)-2-oxo-4,5-diphenylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 129438808 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | ethyl (3S,4S,5S)-2-oxo-4,5-diphenylpyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)N[C@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H19NO3/c1-2-23-19(22)16-15(13-9-5-3-6-10-13)17(20-18(16)21)14-11-7-4-8-12-14/h3-12,15-17H,2H2,1H3,(H,20,21)/t15-,16+,17-/m1/s1 |
| InChIKey | IQRDZUDYQJFSSK-IXDOHACOSA-N |
| XLogP | 2.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|