C22H24O4 — CID 15261796
diethyl (1R,2S,3R,4S)-3,4-diphenylcyclobutane-1,2-dicarboxylate (PubChem CID 15261796) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is diethyl (1R,2S,3R,4S)-3,4-diphenylcyclobutane-1,2-dicarboxylate.
| Compound Name | diethyl (1R,2S,3R,4S)-3,4-diphenylcyclobutane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 15261796 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | diethyl (1R,2S,3R,4S)-3,4-diphenylcyclobutane-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](C(=O)OCC)[C@@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H24O4/c1-3-25-21(23)19-17(15-11-7-5-8-12-15)18(16-13-9-6-10-14-16)20(19)22(24)26-4-2/h5-14,17-20H,3-4H2,1-2H3/t17-,18+,19+,20- |
| InChIKey | BULTWXSCCHUVCB-JVSBHGNQSA-N |
| XLogP | 3.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |