C18H17BrO2 — CID 142718704
ethyl 2-(2-bromophenyl)-3-phenylcyclopropane-1-carboxylate (PubChem CID 142718704) has the molecular formula C18H17BrO2 and a molecular weight of 345.24 g/mol. Its IUPAC name is ethyl 2-(2-bromophenyl)-3-phenylcyclopropane-1-carboxylate.
| Compound Name | ethyl 2-(2-bromophenyl)-3-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 142718704 |
| Molecular Formula | C18H17BrO2 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | ethyl 2-(2-bromophenyl)-3-phenylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1C(c2ccccc2)C1c1ccccc1Br |
| InChI | InChI=1S/C18H17BrO2/c1-2-21-18(20)17-15(12-8-4-3-5-9-12)16(17)13-10-6-7-11-14(13)19/h3-11,15-17H,2H2,1H3 |
| InChIKey | DXXLLSOZIUFWBI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |