About ethyl 2-bromobicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylate
ethyl 2-bromobicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylate (PubChem CID 131530657) has the molecular formula C11H11BrO2
and a molecular weight of 255.11 g/mol. Its IUPAC name is ethyl 2-bromobicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylate.
Analyze ethyl 2-bromobicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-bromobicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylate?
The IUPAC name of ethyl 2-bromobicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylate (CID 131530657) is ethyl 2-bromobicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylate.
What is the SMILES notation for ethyl 2-bromobicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylate?
The canonical SMILES for ethyl 2-bromobicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylate is CCOC(=O)C1Cc2c(Br)cccc21.
What is the InChIKey of ethyl 2-bromobicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylate?
The InChIKey is OHOPNVNXIORMOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrO2/c1-2-14-11(13)9-6-8-7(9)4-3-5-10(8)12/h3-5,9H,2,6H2,1H3.
What are the key properties of ethyl 2-bromobicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylate?
ethyl 2-bromobicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylate has a molecular weight of 255.11 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-bromobicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylate is sourced from PubChem (CID 131530657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).