C12H13NO3 — CID 91387583
ethyl (1R)-5-amino-3-oxo-1,2-dihydroindene-1-carboxylate (PubChem CID 91387583) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is ethyl (1R)-5-amino-3-oxo-1,2-dihydroindene-1-carboxylate.
| Compound Name | ethyl (1R)-5-amino-3-oxo-1,2-dihydroindene-1-carboxylate |
|---|---|
| PubChem CID | 91387583 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | ethyl (1R)-5-amino-3-oxo-1,2-dihydroindene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC(=O)c2cc(N)ccc21 |
| InChI | InChI=1S/C12H13NO3/c1-2-16-12(15)10-6-11(14)9-5-7(13)3-4-8(9)10/h3-5,10H,2,6,13H2,1H3/t10-/m1/s1 |
| InChIKey | ZTXYWJKFVUOMKH-SNVBAGLBSA-N |
| XLogP | 1.50 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|