C12H10F2O3 — CID 122554456
ethyl 5,6-difluoro-3-oxo-1,2-dihydroindene-2-carboxylate (PubChem CID 122554456) has the molecular formula C12H10F2O3 and a molecular weight of 240.20 g/mol. Its IUPAC name is ethyl 5,6-difluoro-3-oxo-1,2-dihydroindene-2-carboxylate.
| Compound Name | ethyl 5,6-difluoro-3-oxo-1,2-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 122554456 |
| Molecular Formula | C12H10F2O3 |
| Molecular Weight | 240.20 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | ethyl 5,6-difluoro-3-oxo-1,2-dihydroindene-2-carboxylate |
| SMILES | CCOC(=O)C1Cc2cc(F)c(F)cc2C1=O |
| InChI | InChI=1S/C12H10F2O3/c1-2-17-12(16)8-3-6-4-9(13)10(14)5-7(6)11(8)15/h4-5,8H,2-3H2,1H3 |
| InChIKey | QEBIOVLDGYRGQH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|