C16H18F2N2O3 — CID 124927417
ethyl (3S)-6,7-difluoro-4-oxo-1-pyrrolidin-1-yl-2,3-dihydroquinoline-3-carboxylate (PubChem CID 124927417) has the molecular formula C16H18F2N2O3 and a molecular weight of 324.33 g/mol. Its IUPAC name is ethyl (3S)-6,7-difluoro-4-oxo-1-pyrrolidin-1-yl-2,3-dihydroquinoline-3-carboxylate.
| Compound Name | ethyl (3S)-6,7-difluoro-4-oxo-1-pyrrolidin-1-yl-2,3-dihydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 124927417 |
| Molecular Formula | C16H18F2N2O3 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | ethyl (3S)-6,7-difluoro-4-oxo-1-pyrrolidin-1-yl-2,3-dihydroquinoline-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CN(N2CCCC2)c2cc(F)c(F)cc2C1=O |
| InChI | InChI=1S/C16H18F2N2O3/c1-2-23-16(22)11-9-20(19-5-3-4-6-19)14-8-13(18)12(17)7-10(14)15(11)21/h7-8,11H,2-6,9H2,1H3/t11-/m0/s1 |
| InChIKey | QESBKAMKJZHTEZ-NSHDSACASA-N |
| XLogP | 2.16 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|